p-Nitrophenylalanine is a derivative of L-phenylalanine where a nitro group is attached at the 4-position of the phenyl ring. It is used primarily as a research compound.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 949-99-5
(2S)-2-amino-3-(4-nitrophenyl)propanoic acid;hydrate
Pharmaceutical intermediate for peptide synthesis
2,4-Difluorocinnamic acid
research compound for crystal engineering
2-Methoxyestrone-1,4,16,16-d4
Deuterated analytical reference standard
Sodium 2-[(difluoromethyl)sulfanyl]acetate
Research reagent
5-Norbornene-2-methanol
olefin metathesis research reagent
(2S)-2-amino-3-(4-nitrophenyl)propanoic acid
GTVVZTAFGPQSPC-QMMMGPOBSA-N
C1=CC(=CC=C1C[C@@H](C(=O)O)N)[N+](=O)[O-]