2,3,4,5-Tetrafluorobenzoyl chloride is a fluorinated aromatic acyl chloride used as a pharmaceutical intermediate. It serves as a building block in the synthesis of active pharmaceutical ingredients due to its reactive carbonyl chloride group and multiple fluorine substituents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 94695-48-4
Ethyl 3-oxo-(2,3,4,5-tetrafluorophenyl)propanoate
Pharmaceutical intermediate for synthesis
2,2-Diphenylacetaldehyde
pharmaceutical intermediate synthesis
Tert-Butyl trans-4-ethynylcyclohexylcarbamate
Pharmaceutical intermediate
N-a-Fmoc-a-aminoisobutyric acid, N-fmoc-c-a-methylalanine
peptide synthesis building block
2,3,4,5-tetrafluorobenzoyl chloride
XWCKIXLTBNGIHV-UHFFFAOYSA-N
C1=C(C(=C(C(=C1F)F)F)F)C(=O)Cl