This compound is a fluorinated methacrylate monomer, specifically this compound. It is used as a research reagent in polymer chemistry for the synthesis of fluorinated polymers with specialized properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 944480-10-8
2-[2-(2-Propynyloxy)ethoxy]ethylamine
Click chemistry building block
6-BROMO-2,3-DIHYDRO-3-BENZOFURANAMINE
research compound
4-[[[(6S)-2-Amino-5-formyl-3,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl]methyl]amino]benzoic acid
research compound
D-Phenylalanyl Nateglinide
research compound
[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] 2-methylprop-2-enoate
BKUNBDQVOHMIAE-UHFFFAOYSA-N
CC(=C)C(=O)OC(C)(C)C(C(F)(F)F)(C(F)(F)F)O
—