This compound is a sulfur-containing organic acid used as a pharmaceutical intermediate in research and manufacturing. Its structure features a phenyl ring and a thioester group, contributing to its reactivity in chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Acetic acid, [(phenylthioxomethyl)thio]- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Sodium 1-benzyl-5-phenylbarbiturate
pharmaceutical intermediate
4-(benzyloxy)-2-methyl-1H-benzo[d]imidazole-6-carboxylic acid
Pharmaceutical intermediate
4-(Benzyloxy)-N,N,2-trimethyl-1-tosyl-1H-benzo[d]imidazole-6-carboxamide
pharmaceutical intermediate
4-Hydroxy-N,N,2-trimethyl-1-((4-methylphenyl)sulfonyl)-1H-benzimidazole-6-carboxamide
Pharmaceutical intermediate chemical
2-(benzenecarbonothioylsulfanyl)acetic acid
XBEIANFIOZTEDE-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=S)SCC(=O)O
Acetic acid, [(phenylthioxomethyl)thio]- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.