This compound is a chemical compound primarily used as an agrochemical intermediate in the synthesis of fluroxypyr, a herbicide. It is a halogen-substituted heterocyclic amine.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Amino-3,5-dichloro-6-fluoro-2-pyridone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Fluoro-6-(trifluoromethyl)pyridine
Crop protection intermediate
N-(N-Butyl)thiophosphoric triamide
soil amendment fertilizer
Acetochlor ESA sodium salt
herbicide reference standard
3-Chloro-4-methylaniline
intermediate for herbicides and pesticides
4-amino-3,5-dichloro-6-fluoro-1H-pyridin-2-one
JPMASQTVFRLSAV-UHFFFAOYSA-N
C1(=C(C(=O)NC(=C1Cl)F)Cl)N
4-Amino-3,5-dichloro-6-fluoro-2-pyridone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.