Ethyl 4-(butylamino)benzoate is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an ester and an amine functional group, making it suitable for incorporation into more complex drug molecules during synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 94-32-6
5-Chlorobenzotriazole
peptide coupling reagent intermediate
2-Amino-N-(2-(2-chlorobenzoyl)-4-nitrophenyl)acetamide hydrochloride
Pharmaceutical intermediate
(R)-2-(4-Hydroxyphenoxy)propanoic acid
Pharmaceutical intermediate for herbicide synthesis
(2S,3aS,7aS)-Benzyl octahydro-1H-indole-2-carboxylate 4-methylbenzenesulfonate
Perindopril intermediate
ethyl 4-(butylamino)benzoate
GTXRSQYDLPYYNW-UHFFFAOYSA-N
CCCCNC1=CC=C(C=C1)C(=O)OCC