N-tert-butoxycarbonyl-3-iodo-L-alanine methyl ester is a chemical compound used as a pharmaceutical intermediate in the manufacture of active pharmaceutical ingredients. It features an iodine atom and protected amino acid structure, making it suitable for peptide synthesis and related applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93267-04-0
5-bromo-3-[[(2R)-1-methyl-2-pyrrolidinyl]methyl]-1H-Indole
Pharmaceutical intermediate for APIs
{3-[(tert-butoxy)carbonyl]phenyl}boronic acid
Pharmaceutical intermediate for APIs
4-Amino-5-chloro-2-methoxybenzoic acid
Pharmaceutical intermediate for APIs
O-Toluoyl chloride
Pharmaceutical intermediate
6,6'-(9H-Fluoren-9-ylidene)bis(2-naphthalenol)
pharmaceutical intermediate
2-Chlorotrityl chloride
Pharmaceutical intermediate
1-Chloroadamantane
pharmaceutical intermediate for amantadine synthesis
methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
UGZBFCCHLUWCQI-LURJTMIESA-N
CC(C)(C)OC(=O)N[C@@H](CI)C(=O)OC