3,4-Dimethoxybenzoic acid is a chemical compound used as an intermediate in pharmaceutical manufacturing. It features a benzoic acid core substituted with two methoxy groups, contributing to its role in the synthesis of various active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,4-Dimethoxybenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Homoveratric acid
Pharmaceutical intermediate research compound
(r)-4-propylpyrrolidin-2-one
pharmaceutical intermediate
3-(2-chloroethyl)-2-methyl-4H,6H,7H,8H,9H-pyrido[1,2-a]pyrimidin-4-one hydrochloride
pharmaceutical intermediate
1-Benzyl 4-tert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate
pharmaceutical intermediate
3,4-Dimethoxybenzoic acid(CAS 93-07-2)의 국제 HS 코드는 2918.99입니다.
2918.99
2918 99 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
3,4-dimethoxybenzoic acid
DAUAQNGYDSHRET-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)O)OC
3,4-Dimethoxybenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.