3,4-Dimethoxybenzoic acid is a chemical compound used as an intermediate in pharmaceutical manufacturing. It features a benzoic acid core substituted with two methoxy groups, contributing to its role in the synthesis of various active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93-07-2
Homoveratric acid
Pharmaceutical intermediate research compound
(r)-4-propylpyrrolidin-2-one
pharmaceutical intermediate
3-(2-chloroethyl)-2-methyl-4H,6H,7H,8H,9H-pyrido[1,2-a]pyrimidin-4-one hydrochloride
pharmaceutical intermediate
1-Benzyl 4-tert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate
pharmaceutical intermediate
3,4-dimethoxybenzoic acid
DAUAQNGYDSHRET-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)O)OC