This compound is a polyfunctional quinazoline derivative characterized by four aromatic rings, multiple ether and amine groups, and a high polar surface area, reflecting its role as a pharmaceutical intermediate. Its structure is built around two substituted quinazoline-2,4-diamine cores linked by a propylamine chain, indicating use in complex organic synthesis for drug development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 928780-95-4
3-Bromo-6-chloropyridine-2-carboxylic acid
pharmaceutical intermediate
6-Benzyloxypyridine-3-boronic acid
Pharmaceutical intermediate for boronic acid synthesis
Rac N-Benzyl Nebivolol
Pharmaceutical intermediate
Maxacalcitol Impurity 8
Pharmaceutical impurity reference standard
2-N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]propyl]-6,7-dimethoxyquinazoline-2,4-diamine
CEKUOLRGTZEHMC-UHFFFAOYSA-N
CN(CCCNC1=NC2=CC(=C(C=C2C(=N1)N)OC)OC)C3=NC4=CC(=C(C=C4C(=N3)N)OC)OC