(2H9)-tert-Butyl chloride is a deuterated analog of tert-butyl chloride, where all nine hydrogen atoms are replaced with deuterium. It is primarily used as a deuterated research standard in analytical and chemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2H9)-tert-Butyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,4-DICHLORO-5H,6H,7H-CYCLOPENTA[D]PYRIDAZINE
research compound
1-Methyl-4-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piperazine
Research compound
2-Amino-3,5-dibromo-6-methylpyridine
research compound
(5alpha,11beta)-11-[4-(Dimethylamino)phenyl]-5-hydroxy-estr-9-ene-3,17-dione Cyclic 3-(1,2-Ethanediyl Acetal)
research compound
2-Chloro-2-methylpropane
Intermediate for fine chemical synthesis
(2H9)-tert-Butyl chloride(CAS 918-20-7)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-chloro-1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane
NBRKLOOSMBRFMH-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])Cl
(2H9)-tert-Butyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.