Peracetyl Empagliflozin is a peracetylated derivative of the pharmaceutical compound empagliflozin, used as a research reagent in laboratory settings. This structural modification serves to protect hydroxyl groups during synthetic studies or analytical investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Peracetyl Empagliflozin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,4-Anhydro-2-deoxy-D-ribitol
research compound
5-BROMO-1H-PYRAZOLO[3,4-B]PYRIDINE-3-CARBALDEHYDE
chemical research reagent
2-Bromo-8-iododibenzofuran
Research compound
4-(Nitrosoamino)benzoic acid
Nitrosamine reference standard
엠파글리플로진
sodium-glucose cotransporter 2 inhibitor
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]oxan-2-yl]methyl acetate
IVTYEGRDCQLUJE-KTUPMIEBSA-N
CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)C2=CC(=C(C=C2)Cl)CC3=CC=C(C=C3)O[C@H]4CCOC4)OC(=O)C)OC(=O)C)OC(=O)C
Peracetyl Empagliflozin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.