Antioxidant AO-80 is a sterically hindered phenolic compound used primarily as an antioxidant for polymers. It features a complex structure with multiple ether and ester linkages, designed to provide thermal and oxidative stability to polymer materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Antioxidant ao-80 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Bis(2,6-di-tert-butyl-4-methylphenyl)pentaerythritol diphosphite
antioxidant for polymers
3,5,7-Trimethyldecane
Processing solvent
1-Propanol, 2-(dodecyloxy)-
surfactant intermediate
CYCLOHEXANONE
Industrial solvent for paints and resins
METHYL 2-BROMO-5-METHYLBENZOATE
synthetic intermediate
[2-[3-[1-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]-2-methylpropan-2-yl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate
CGRTZESQZZGAAU-UHFFFAOYSA-N
CC1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)OCC(C)(C)C2OCC3(CO2)COC(OC3)C(C)(C)COC(=O)CCC4=CC(=C(C(=C4)C)O)C(C)(C)C
Antioxidant ao-80 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.