This compound is a complex polycyclic carboxylic acid derivative with multiple stereocenters, featuring an ethoxycarbonylamino substituent and a fused lactone ring. It is primarily used as an intermediate in pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl ((1R,3aR,4aR,6R,8aR,9S,9aS)-9-(diphenylcarbamoyl)-1-methyl-3-oxododecahydronaphtho[2,3-c]furan-6-yl)carbamate
pharmaceutical intermediate
2-[4,5-diethoxy-2-(ethoxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol
pharmaceutical excipient and coating agent
Ethylene glycol monostearate
surfactant and emulsifier in pharmaceuticals
6-Hydroxy-2-methoxy-7-deazapurine
Pharmaceutical intermediate
4'-ETHYL-3-FLUOROBIPHENYL-4-BORONIC ACID
pharmaceutical intermediate
(1R,3aR,4aR,6R,8aR,9S,9aR)-6-(ethoxycarbonylamino)-1-methyl-3-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-9-carboxylic acid
IYJNBOZDJDFHBC-DKYFYASOSA-N
CCOC(=O)N[C@@H]1CC[C@@H]2[C@@H](C1)C[C@@H]3[C@H]([C@H]2C(=O)O)[C@H](OC3=O)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.