3,4,5-Trimethoxycinnamic acid is a methoxycinnamic acid with three methoxy groups at positions 3, 4, and 5 on the aromatic ring. It has been identified as an allergen and is found in plants such as Polygala tenuifolia, Piper swartzianum, and Piper tuberculatum.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 90-50-6
2-Propenoic acid, 3-(4-hydroxy-3,5-dimethoxyphenyl)-, (E)-
MALDI matrix for protein determination
2-Ethylphenylboronic acid (contains varying amounts of Anhydride)
Boronic acid research reagent
Fmoc-asp(otbu)-(dmb)gly-oh
research compound for peptide synthesis
Elastase
Proteolytic enzyme for research
3-Adtpp
nucleotide analog research reagent
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid
YTFVRYKNXDADBI-SNAWJCMRSA-N
COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)O