Methyl 4-iodo-3-nitrobenzoate is a research compound studied for its potential local anesthetic properties. It is structurally related to dimethocaine and is primarily used in laboratory investigations of anesthetic activity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 89976-27-2
3,4-dimethoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
(R)-4-hydroxy-N,N-diphenylpent-2-ynamide
research compound
(E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid
Research compound
Magnesium chloride 3,5-dimethoxybenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
methyl 4-iodo-3-nitrobenzoate
SCMBIQRYVKITCY-UHFFFAOYSA-N
COC(=O)C1=CC(=C(C=C1)I)[N+](=O)[O-]