This compound is a polymeric-type industrial chemical with a large, flexible molecular structure. Its complex architecture features multiple aromatic rings, amine groups, and ester linkages, which contribute to its high molecular weight and hydrophobic character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,1-bis(acryloyloxymethyl)ethyl isocyanate
crosslinking agent monomer
Dimethyl 2,5-Dioxahexanedioate
intermediate for polyester synthesis
PPG-2 methyl ether acetate
solvent in coatings and inks
3,3,3-trifluoro-2,2-dimethylpropanoic acid
chemical intermediate for synthesis
Poly(oxy-1,2-ethanediyl), alpha-(3-(4-(4-(2-(dimethylamino)-2-(phenylmethyl)-1-oxobutyl)phenyl)-1-piperazinyl)-1-oxopropyl)-omega-(3-(4-(4-(2-(dimethylamino)-2-(phenylmethyl)-1-oxobutyl)phenyl)-1-piperazinyl)-1-oxopropoxy)-(CAS 886463-10-1)의 국제 HS 코드는 3815.90, 3907.29입니다.
3815.90, 3907.29
3815 90 90, 3907 29 99
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-[3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanoyloxy]ethyl 3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanoate
XYNGFZCNHCODJJ-UHFFFAOYSA-N
CCC(CC1=CC=CC=C1)(C(=O)C2=CC=C(C=C2)N3CCN(CC3)CCC(=O)OCCOC(=O)CCN4CCN(CC4)C5=CC=C(C=C5)C(=O)C(CC)(CC6=CC=CC=C6)N(C)C)N(C)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.