2-(1H-indol-5-yl)benzoic acid is an indole-containing aromatic carboxylic acid used as a research compound. It features both a benzoic acid moiety and an indole ring system, contributing to its structural properties for laboratory investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 886363-17-3
5-Bromo-4-methylpyridine-2-carbonitrile
research reagent
5-Bromo-4-methylpyridine-2-carboxylic acid
research compound
2-(2-(1h-indol-5-yl)phenyl)acetic acid
research compound
3-(1H-indol-5-yl)benzoic Acid
Research compound
4-(1H-indol-5-yl)benzoic Acid
research compound
2-(4-(1h-indol-5-yl)phenyl)acetic acid
pharmaceutical intermediate
2-(1H-indol-5-yl)benzoic acid
PKGXRKSYWVXMKT-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=CC3=C(C=C2)NC=C3)C(=O)O