6-Bromo-1H-indazole-4-carboxylic acid is a brominated indazole derivative used primarily as a research compound. It features a carboxylic acid functional group and an aromatic heterocyclic ring system, making it valuable for laboratory and synthetic chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 885523-08-0
4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane
boronic ester for organic synthesis
1-acetyl-4-bromo-1H-indazole
research compound
C-FMS inhibitor
c-FMS kinase inhibitor research compound
6-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanoic acid
Fmoc-protected amino acid reagent
6-bromo-1H-indazole-4-carboxylic acid
YYONCBWTWPVWRT-UHFFFAOYSA-N
C1=C(C=C2C(=C1C(=O)O)C=NN2)Br
—