2-Bromo-4,5-difluorophenylacetic acid is a chemical compound used as a pharmaceutical intermediate. It features a bromine and two fluorine substituents on an aromatic ring, along with a carboxylic acid group, contributing to its utility in medicinal chemistry synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Bromo-4,5-difluorophenylacetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tert-Butyl (1,4'-bipiperidin-4-ylmethyl)-carbamate
Pharmaceutical intermediate for drug synthesis
3-(2-(Benzylamino)ethyl)quinazoline-2,4(1H,3H)-dione
pharmaceutical intermediate compound
2,4,5-Trifluorobenzoyl chloride
Pharmaceutical intermediate synthesis
5-chloro-6-methoxypyridine-3-carboxylic acid
Pharmaceutical intermediate
2-(2-bromo-4,5-difluorophenyl)acetic acid
FQSLXVRCDYUESO-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)Br)CC(=O)O
—
2-Bromo-4,5-difluorophenylacetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.