2,6-dibromo-4-(trifluoromethoxy)benzenamine is a brominated aniline derivative with an ether-linked trifluoromethoxy group. It is primarily utilized as a research reagent in chemical and pharmaceutical development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,6-dibromo-4-(trifluoromethoxy)benzenamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
8-BROMO-2-METHOXY-1,5-NAPHTHYRIDINE
Research compound
Decanoic-d19 acid
deuterated research reference standard
6-Chloro-4-phenyl-1,4-dihydroquinazoline-2-carboxylic acid
research compound
3-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
research compound
2,6-dibromo-4-(trifluoromethoxy)aniline
JBSWOEGXMADXOU-UHFFFAOYSA-N
C1=C(C=C(C(=C1Br)N)Br)OC(F)(F)F
—
2,6-dibromo-4-(trifluoromethoxy)benzenamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.