2-Amino-5-chloro-4-methylbenzenesulfonic acid is an organic compound used as an intermediate in the production of paints and pigments. It features an aromatic ring substituted with amine, sulfonic acid, and chloro functional groups, which contribute to its chemical reactivity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 88-53-9
2,4-Diaminobenzenesulfonic acid
Dye intermediate for azo dyes
4-Acetamido-2-aminobenzenesulfonic acid
dye intermediate
2-NITROANILINE
Intermediate for azo dyes and pigments
4-Chloro-3-(3-methyl-5-oxo-2-pyrazolin-1-yl)benzenesulfonic acid
Pyrazolone dye intermediate
2-amino-5-chloro-4-methylbenzenesulfonic acid
VYZCFAPUHSSYCC-UHFFFAOYSA-N
CC1=CC(=C(C=C1Cl)S(=O)(=O)O)N