This compound is a sterically hindered phenolic antioxidant used primarily as an industrial additive. It features an aromatic ring with a tert-butyl-substituted phenol group and a dimethylaminomethyl substituent, contributing to its antioxidant activity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 88-27-7
2,6-ditert-butyl-4-[(dimethylamino)methyl]phenol
VMZVBRIIHDRYGK-UHFFFAOYSA-N
CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CN(C)C