This compound is a chiral alcohol used as a research reagent. It features a stereocenter and contains an aromatic ring substituted with chlorine and fluorine atoms, contributing to its specific molecular properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 877397-65-4
Tert-butyl 4-(4-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate
Research compound for synthesis
Tetrabutylammonium fluoride trihydrate
Phase transfer catalyst and fluorination reagent
H2-Gamendazole
research compound
KG 5
research compound
(alphaR)-2,6-Dichloro-3-fluoro-alpha-methylbenzenemethanol
pharmaceutical intermediate
(1S)-1-(2,6-dichloro-3-fluorophenyl)ethanol
JAOYKRSASYNDGH-BYPYZUCNSA-N
C[C@@H](C1=C(C=CC(=C1Cl)F)Cl)O