4-Bromo-2-nitroaniline is a chemical compound used primarily as a dye intermediate. It features an amine group attached to an aromatic ring with bromine and nitro substituents, making it suitable for synthesizing various dyes and pigments.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 875-51-4
2,4,6-TRIMETHYLANILINE
Dye intermediate
2-Amino-3,5-dimethylbenzenesulfonic acid
Dye intermediate
3-Amino-5-chloro-2-hydroxybenzenesulfonic acid
Dye intermediate for azo dyes
5-Amino-2-chlorobenzenesulfonic Acid
Intermediate for pigment red 58
4-bromo-2-nitroaniline
ZCWBZRBJSPWUPG-UHFFFAOYSA-N
C1=CC(=C(C=C1Br)[N+](=O)[O-])N