m-PEG7-acid is a monodisperse polyethylene glycol (PEG) derivative containing a terminal carboxylic acid group. It is primarily used as a research reagent for PEGylation, a process that modifies biomolecules or surfaces to improve solubility and stability.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
M-PEG7-acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2-Cyanopyridin-3-yl)boronic acid
research compound for boronic acid chemistry
3-p-Anisoyl Acacetin
Impurity reference standard for acacetin
(S)-benzyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
L-Phenylalanine, (alphaS)-alpha-[[2-(4-morpholinyl)acetyl]amino]benzenebutanoyl-L-leucyl-, phenylmethyl ester
research compound
3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
NOPQIPMESCUIHH-UHFFFAOYSA-N
COCCOCCOCCOCCOCCOCCOCCC(=O)O
M-PEG7-acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.