2,4-Di-tert-butyl-5-nitrophenol is a substituted phenol compound used as a pharmaceutical intermediate. It features both tert-butyl groups and a nitro group on an aromatic ring, contributing to its structural properties relevant for chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,4-di-tert-butyl-5-nitrophenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
16-(2H-tetrazol-5-yl)hexadecanoic acid
pharmaceutical intermediate
2-(2-Aminoanilino)-5-methylthiophene-3-carbonitrile
Pharmaceutical intermediate for API synthesis
(r)-tetrahydrofuran-2-carboxylic acid
pharmaceutical intermediate
(S)-(-)-Tetrahydro-2-furoic acid
Pharmaceutical intermediate for active compounds
2,4-ditert-butyl-5-nitrophenol
VIWYWRSFQRIVPI-UHFFFAOYSA-N
CC(C)(C)C1=CC(=C(C=C1[N+](=O)[O-])O)C(C)(C)C
2,4-di-tert-butyl-5-nitrophenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.