1,5-This compound is a chemical compound used as a research reagent. It is characterized by the presence of ester and halogen functional groups, contributing to its reactivity in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 870-78-0
Ethyl 2-bromobutyrate
n.a
1,6-diethyl 2,5-dibromohexanedioate
research compound
2-chloro-3-fluoro-5-hydroxypyridine
research compound
Methyl 3-(5-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
4-Cyano-4-(dodecylsulfanylthiocarbonyl)sulfanylpentanoic acid
RAFT polymerization chain transfer agent
2-Cyano-2-propyl dodecyl trithiocarbonate
RAFT polymerization chain transfer agent
diethyl 2,4-dibromopentanedioate
DUSLEJGELFKEAS-UHFFFAOYSA-N
CCOC(=O)C(CC(C(=O)OCC)Br)Br
—