4-Chlorobenzoic Acid-d4 is a deuterium-labeled analytical reference standard, specifically the tetradeuterated form of 4-chlorobenzoic acid where all four aromatic hydrogen atoms are replaced with deuterium. It is primarily used as a stable isotope internal standard in quantitative analysis, enabling accurate measurement of the non-deuterated compound in complex matrices.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Chlorobenzoic Acid-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-NITROBENZOIC-D4 ACID
Deuterated analytical standard
6-bromo-2(1h)-pyridinethione
research compound
6-Bromopyridine-2-sulfonamide
Research reagent
2-Nitroso-2-azaspiro[4,5]decan-3-one
nitrosamine impurity reference standard
4-Chlorobenzoic acid
Intermediate for dyes, fungicides, and pharmaceuticals
4-chloro-2,3,5,6-tetradeuteriobenzoic acid
XRHGYUZYPHTUJZ-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])Cl)[2H]
4-Chlorobenzoic Acid-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.