This compound is a research linker reagent featuring a complex polycyclic core with multiple ether and ester functionalities, including a succinate ester group and a trityl-type protecting group. Its significance lies in its use as a building block in chemical synthesis and pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Phosphonic acid, p-((4-((4-hydroxy-3-(1-methylethyl)phenyl)methyl)-3,5-dimethylphenoxy)methyl)-
certified reference standard impurity
Ru(bpm)3(PF6)2
photoredox catalyst
3',5'-TIPS-N-Ac-Cytidine
protected nucleoside research compound
9-(4-bromophenyl)phenanthrene
research compound
4-[[(3aS,4S,5S,6R,7R,7aR)-6-[bis(4-methoxyphenyl)-phenylmethoxy]-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl]oxy]-4-oxobutanoic acid
KPROLRFVRRGFBD-RHEFJYAGSA-N
COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)O[C@@H]4[C@H]5[C@H]6[C@@H]([C@@H]([C@@H]4OC(=O)CCC(=O)O)O5)C(=O)N(C6=O)C7=CC=CC=C7
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.