This compound is a salt-like organophosphorus compound used as a nucleating agent in plastic materials. It is typically incorporated into polymers at a concentration around 0.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 85209-91-2
ADK Stab NA 21E
plastic additive and stabilizer
4'-(TRANS-4-PROPYLCYCLOHEXYL)-3,4-DIFLUOROBIPHENYL
liquid crystal intermediate
1,2,3,4-Butanetetracarboxylic acid, tetramethyl ester, reaction products with 1,2,2,6,6-pentamethyl-4-piperidinol and .beta.,.beta.,.beta.',.beta.'-tetramethyl-2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diethanol
plastic additive
Trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
Coating composition for glass and textiles
1-butoxyethyl methacrylate
methacrylate monomer for polymer synthesis
sodium 1,3,7,9-tetratert-butyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide
ZHROMWXOTYBIMF-UHFFFAOYSA-M
CC(C)(C)C1=CC2=C(C(=C1)C(C)(C)C)OP(=O)(OC3=C(C2)C=C(C=C3C(C)(C)C)C(C)(C)C)[O-].[Na+]