This compound is a deuterated form of ethanolamine, specifically labeled with four deuterium atoms at the 1,1,2,2 positions. It is primarily significant as a research reagent for isotopic labeling studies, particularly in mass spectrometry and metabolic tracing experiments.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Ethanol-1,1,2,2-d4-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-(tert-Butoxycarbonyl)phenylboronic acid
research reagent for synthesis
2,5-Difluorophenylacetic acid
Research compound for chemical synthesis
2-Fluoro-4-methylbenzonitrile
research compound
(2R)-2-[[2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S,3R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]propanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid
research compound
2-Aminoethanol hydrochloride
removal of acid gases
에탄올아민
metal machining and semiconductor manufacturing additive
2-amino-1,1,2,2-tetradeuterioethanol
HZAXFHJVJLSVMW-LNLMKGTHSA-N
[2H]C([2H])(C([2H])([2H])O)N
Ethanol-1,1,2,2-d4-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.