1-{[(benzyloxy)carbonyl]amino}cyclopropane-1-carboxylic acid is a chemical compound used as a pharmaceutical intermediate, specifically in peptide synthesis. It features a cyclopropane ring with both carboxylic acid and protected amino functional groups, making it suitable for building specialized peptide structures.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 84677-06-5
1-(((Phenylmethoxy)carbonyl)amino)cyclopentanecarboxylic acid
research compound
5-Methyl-2'-o,4'-C-methylenecytidine
nucleoside analogue intermediate
(S)-tert-Butyl (1-(4-bromophenyl)ethyl)carbamate
Pharmaceutical intermediate for synthesis
1-Methyl-1H-pyrazole-4-boronic acid
Pharmaceutical intermediate for synthesis
1-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Pharmaceutical intermediate for synthesis
Benzyl (1-(hydroxymethyl)cyclopropyl)carbamate
peptide synthesis protecting reagent
1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid
KHINKCGJKZSHAJ-UHFFFAOYSA-N
C1CC1(C(=O)O)NC(=O)OCC2=CC=CC=C2