This compound is a triphosphate derivative of 2',3'-dideoxyuridine. It functions as an inhibitor of HIV reverse transcriptase and exhibits potent DNA chain termination activity, making it a valuable probe in molecular biology research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DdUTP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
A-769662
AMPK activator research tool
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Research reagent for organic synthesis
3'-Amino-2',3'-dideoxycytidine
nucleoside analog research reagent
2-Bromo-5-nitropyridin-4-amine
research compound
[[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
OTXOHOIOFJSIFX-POYBYMJQSA-N
C1C[C@@H](O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N2C=CC(=O)NC2=O
DdUTP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.