(4-Cyano-3-fluorophenyl)boronic acid is a boronic acid building block used primarily in research and laboratory settings. It features an aromatic ring with a nitrile group and a halogen substituent, contributing to its utility in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(4-cyano-3-fluorophenyl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Cyano-4-fluorophenylboronic acid
Pharmaceutical intermediate for synthesis
2,6-DICHLOROPYRIDINE-4-BORONIC ACID
boronic acid building block
3-Bromopyridin-4-ylboronic acid
boronic acid building block
1-(tert-butyl) 5-(2,5-dioxopyrrolidin-1-yl) (16-(tert-butoxy)-16-oxohexadecanoyl)-L-glutamate
research chemical intermediate
1-tert-Butyl 18-(2,5-dioxopyrrolidin-1-yl) octadecanedioate
research compound
1-Aminocyclopropane-2,2,3,3-d4-carboxylic acid
deuterated analytical reference standard
4-Nitro-2H-1,2,3-triazole
chemical synthesis intermediate
(4-cyano-3-fluorophenyl)boronic acid
DECWLXUOZUMPBF-UHFFFAOYSA-N
B(C1=CC(=C(C=C1)C#N)F)(O)O
(4-cyano-3-fluorophenyl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.