Ac-Glu(OtBu)-OH is an N-acetylated, side-chain-protected derivative of glutamic acid used as a building block in solid-phase peptide synthesis. Its structure includes a tert-butyl ester protecting group on the side chain carboxyl, enabling selective deprotection during chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 84192-88-1
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
1-(5-Bromoquinoxalin-6-yl)thiourea
research compound for biochemical studies
2-Amino-4-bromopyridine
research compound
4'-Benzyloxyphenyl acetylene
Research compound for organic synthesis
([1,2,4]Triazolo[4,3-b]pyridazin-6-yloxy)acetic acid
certified reference standard
(2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
FALCCLKESWGSNI-QMMMGPOBSA-N
CC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)O