Hydroxy-alpha-sanshool is a fatty amide found in Sichuan pepper species, such as Zanthoxylum schinifolium, Zanthoxylum bungeanum, and Zanthoxylum piperitum. It is the compound primarily responsible for the characteristic pungent and tingling flavor associated with these peppers.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 83883-10-7
3-Hexanone, 5-mercapto-5-methyl-
Flavor and fragrance ingredient
Methyl 5-allyl-3-methoxysalicylate
flavor and fragrance ingredient
2,4,6-TRICHLOROANISOLE
off-flavor agent in wine corks
BETA-CARYOPHYLLENE
Fragrance and flavoring agent
(2E,6Z,8E,10E)-N-(2-hydroxy-2-methylpropyl)dodeca-2,6,8,10-tetraenamide
LHFKHAVGGJJQFF-UEOYEZOQSA-N
C/C=C/C=C/C=C\CC/C=C/C(=O)NCC(C)(C)O