Hydroxy-alpha-sanshool is a fatty amide found in Sichuan pepper species, such as Zanthoxylum schinifolium, Zanthoxylum bungeanum, and Zanthoxylum piperitum. It is the compound primarily responsible for the characteristic pungent and tingling flavor associated with these peppers.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Hydroxy-alpha-sanshool 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Hexanone, 5-mercapto-5-methyl-
Flavor and fragrance ingredient
Methyl 5-allyl-3-methoxysalicylate
flavor and fragrance ingredient
2,4,6-TRICHLOROANISOLE
off-flavor agent in wine corks
BETA-CARYOPHYLLENE
Fragrance and flavoring agent
(2E,6Z,8E,10E)-N-(2-hydroxy-2-methylpropyl)dodeca-2,6,8,10-tetraenamide
LHFKHAVGGJJQFF-UEOYEZOQSA-N
C/C=C/C=C/C=C\CC/C=C/C(=O)NCC(C)(C)O
Hydroxy-alpha-sanshool 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.