2-Amino-4,5-difluorobenzoic acid is a fluorinated aromatic compound featuring both an amino group and a carboxylic acid group. It is primarily used as a pharmaceutical intermediate in the synthesis of various drug substances.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Amino-4,5-difluorobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl (3S)-3-aminobutanoate
Pharmaceutical intermediate for beta-amino acid derivatives
2-Hepten-4-yn-1-amine,N,6,6-trimethyl-, (2E)-
pharmaceutical intermediate
2,2-Bis(3-amino-4-hydroxyphenyl)hexafluoropropane
Pharmaceutical intermediate for apixaban synthesis
Minocycline Impurity 40
pharmaceutical intermediate
2-amino-4,5-difluorobenzoic acid
DGOZIZVTANAGCA-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)N)C(=O)O
2-Amino-4,5-difluorobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.