Valiolamine is an unsaturated amino sugar and a C-7 aminocyclitol compound. It is recognized as a potent inhibitor of glycosidase enzymes, making it a valuable research reagent in glycobiology studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 83465-22-9
Indole-3-(4'-oxo)butyric acid
research compound
1,4-Dichlorobutane-d8
deuterated research compound
2-Aminomethyl-18-crown-6
synthetic intermediate for crown ether derivatives
Camphor Impurity 14
certified reference standard impurity
(1S,2S,3R,4S,5S)-5-amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol
VDLOJRUTNRJDJO-ZYNSJIGGSA-N
C1[C@@H]([C@@H]([C@H]([C@@H]([C@]1(CO)O)O)O)O)N