3-(Trifluoromethoxy)phenol is a chemical compound featuring a phenol group substituted with a trifluoromethoxy group at the meta position. It is used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-(Trifluoromethoxy)phenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-(4-Nitro-1-oxo-1,3-dihydroisoindol-2-yl)piperidine-2,6-dione
Pharmaceutical intermediate for lenalidomide derivatives
5-acetamido-1,3,4-thiadiazole-2-sulfonic acid
acetazolamide impurity reference standard
N-[(S)-1-Ethoxycarbonyl-3-phenylpropyl]-L-alanine
Enalapril intermediate
Tert-butyl 2-(piperazin-1-yl)acetate dihydrochloride
pharmaceutical intermediate
3-(trifluoromethoxy)phenol
UWLJERQTLRORJN-UHFFFAOYSA-N
C1=CC(=CC(=C1)OC(F)(F)F)O
3-(Trifluoromethoxy)phenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.