2-Bromoethanol-1,1,2,2-d4 is a deuterated form of 2-bromoethanol, primarily used as a research reagent. Its isotopic labeling makes it valuable in studies involving reaction mechanisms and metabolic pathways where tracing the compound is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Bromoethanol-1,1,2,2-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Di-T-Butylphosphine
Organophosphine ligand for catalysis
Disodium glycerophosphate
organic sodium salt reagent
BIS[RHODIUM(A,A,A#,A#-TETRAMETHYL-1,3-BENZENEDIPROPIONIC ACID)]
research catalyst
(2',6'-Dimethoxy-[1,1'-biphenyl]-2-yl)diphenylphosphine
Buchwald-type ligand for cross-coupling
2-BROMOETHANOL
chemical intermediate for synthesis
2-bromo-1,1,2,2-tetradeuterioethanol
LDLCZOVUSADOIV-LNLMKGTHSA-N
[2H]C([2H])(C([2H])([2H])Br)O
2-Bromoethanol-1,1,2,2-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.