This compound is a deuterated form of malonic acid, specifically labeled with deuterium at both the methylene and carboxyl positions. It is primarily used as a research reagent in chemical and biochemical studies, particularly for tracing reaction mechanisms and metabolic pathways due to the presence of deuterium atoms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2H2)Malonic (2H2)acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
TRIBUTYLPHOSPHINE OXIDE
research compound
Pp60v-src Autophosphorylation Site, Tyrosine Kinase Substrate
tyrosine kinase substrate research reagent
Diethyl 2,3-difluoromaleate
research compound
17ALPHA-ESTRADIOL-2,4-D2
deuterated reference standard
Malonic acid
Pharmaceutical intermediate for barbiturates and vitamins
Malonic acid, disodium salt
Buffering agent and chemical intermediate
(2H2)Malonic (2H2)acid(CAS 813-56-9)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
dideuterio 2,2-dideuteriopropanedioate
OFOBLEOULBTSOW-BGOGGDMHSA-N
[2H]C([2H])(C(=O)O[2H])C(=O)O[2H]
(2H2)Malonic (2H2)acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.