This compound is a deuterated form of malonic acid, specifically labeled with deuterium at both the methylene and carboxyl positions. It is primarily used as a research reagent in chemical and biochemical studies, particularly for tracing reaction mechanisms and metabolic pathways due to the presence of deuterium atoms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 813-56-9
TRIBUTYLPHOSPHINE OXIDE
research compound
Pp60v-src Autophosphorylation Site, Tyrosine Kinase Substrate
tyrosine kinase substrate research reagent
Diethyl 2,3-difluoromaleate
research compound
17ALPHA-ESTRADIOL-2,4-D2
deuterated reference standard
Malonic acid
Pharmaceutical intermediate for barbiturates and vitamins
Malonic acid, disodium salt
Buffering agent and chemical intermediate
dideuterio 2,2-dideuteriopropanedioate
OFOBLEOULBTSOW-BGOGGDMHSA-N
[2H]C([2H])(C(=O)O[2H])C(=O)O[2H]