This compound is a deuterated derivative of fluorene in which all ten hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard in mass spectrometry to improve quantification accuracy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 81103-79-9
Progesterone-2,2,4,6,6,17alpha,21,21,21-d9
deuterated internal standard for mass spectrometry
(R,R)-1,2-Bis[(2-methylphenyl)-(phenyl)phosphino]ethane
chiral ligand for asymmetric synthesis
Methyl N-(diphenylmethylidene)glycinate
research intermediate for amino acid derivatives
811794-35-1
organometallic research reagent
(9H-Fluoren-9-yl)methyl 3-aminopiperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
9H-Fluorene
production of resins and dyes
1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene
NIHNNTQXNPWCJQ-QNNBDYQESA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C(=C3C2([2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]