This compound is a protected glycosyl bromide, specifically a per-O-pivaloylated alpha-D-glucopyranosyl bromide. It is primarily used as a building block in the synthesis of oligosaccharides, where the pivaloyl groups serve as protecting groups and the bromide acts as a leaving group for glycosylation reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 4-amino-4-naphthalen-2-yl-butyrate hydrochloride
Pharmaceutical intermediate
3-Aminoethyl-1-N-Cbz-pyrrolidine
Pharmaceutical intermediate
Benzyl 2-(aminomethyl)piperidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
2,4-Difluorophenylacetic acid
Pharmaceutical intermediate for drug synthesis
[(2R,3R,4S,5R,6R)-6-bromo-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate
BSDBCYHGMPHOAL-SFFUCWETSA-N
CC(C)(C)C(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)Br)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.