Musk ketone is a synthetic musk compound used to emulate the scent of natural animal musks. It has a clean, smooth, and sweet odor and serves as a fixative in perfumes, cosmetics, and detergents, providing a long-lasting base note.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 81-14-1
1-(4-tert-butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone
WXCMHFPAUCOJIG-UHFFFAOYSA-N
CC1=C(C(=C(C(=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-])C)C(=O)C