This compound is a pharmaceutical intermediate primarily used in the manufacturing of cephalosporin antibiotics. It is characterized by a thiazole ring and multiple polar functional groups, making it suitable for use in chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 80544-17-8
(Z)-2-(2-Aminothiazol-4-yl)-2-carboxymethoxyiminoacetic acid
pharmaceutical impurity reference standard
(z)-2-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonylmethoxyimino)acetic acid
Pharmaceutical intermediate for cephalosporin
4'-Chloro[1,1'-biphenyl]-4-carbaldehyde
Pharmaceutical intermediate
(6alpha,11beta)-6,9-difluoro-11,17,21-trihydroxypregna-1,4-diene-3,20-dione
pharmaceutical intermediate for corticosteroid synthesis
N2-ISOBUTYRYL-2'-FLUORO-2'-DEOXYGUANOSINE
nucleoside analog intermediate
Ceftriaxone Impurity D
pharmaceutical impurity reference standard
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoacetic acid
AGFYEFQBXHONNW-WDZFZDKYSA-N
COC(=O)CO/N=C(/C1=CSC(=N1)N)\C(=O)O