1-Bromoacetylpyrene is a chemical compound used as a research reagent in organic synthesis. Its structure features a pyrene core substituted with a bromoacetyl group, making it a versatile building block for laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Bromoacetylpyrene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Phenylmaleimide
Research reagent for chemical synthesis
3-Chloro-4-pyridineboronic acid
Research reagent for chemical synthesis
7-bromo-1H-indazole
Research reagent for chemical synthesis
4-(Aminosulphonyl)benzeneboronic acid
Research reagent for chemical synthesis
4,4'-dibromobiphenyl-d8
Deuterated analytical reference standard
8-Hydroxyacyclovir
metabolite of acyclovir
1,2-Dimyristoyl-sn-glycero-3-phosphate, sodium salt
phospholipid research reagent
Isopropylmagnesium chloride lithium chloride complex
Grignard reagent
2-bromo-1-pyren-1-ylethanone
KAEDEGFCOPIKKM-UHFFFAOYSA-N
C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C(=O)CBr
1-Bromoacetylpyrene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.