This compound is a beta-lactam-structured pharmaceutical intermediate specifically used in the manufacture of cephalosporin antibiotics. It features multiple ring systems and polar functional groups consistent with its role in antibiotic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 80370-59-8
(6R,7R)-7-Amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
cephalosporin antibiotic intermediate
(1R)-1-(4-Bromophenyl)-2,2,2-trifluoroethan-1-ol
Pharmaceutical intermediate
(6alpha,11beta,16alpha,17alpha)-6,9-difluoro-11-hydroxy-16-methyl-3-oxo-17-(1-oxopropoxy)androsta-1,4-diene-17-carbothioic acid
Pharmaceutical intermediate for fluticasone propionate
Acetazolamide Impurity F
pharmaceutical impurity standard
2-aminocyclopentane-1-carbonitrile
pharmaceutical intermediate
(6R,7R)-7-amino-3-(furan-2-carbonylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
ZMPDMYFTSINIIZ-LDYMZIIASA-N
C1C(=C(N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)CSC(=O)C3=CC=CO3