This compound is a chlorinated naphthalenimine derivative used as a research reagent. Its structure features two aromatic rings and two halogen substituents, with a molecular weight and lipophilicity suitable for laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
2-Amino-5-bromopyrazine
Research compound for chemical synthesis
2,5-Difluorophenylacetic acid
Research compound for chemical synthesis
2-Bromo-5-(trifluoromethyl)benzyl alcohol
Research compound for chemical synthesis
N-Acetyl-3-sulfo-L-alanine
impurity reference standard
Crassicauline A
toxic diterpene alkaloid plant metabolite
2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic Acid
research compound
2,5-Dibromo-3-(trifluoromethyl)pyridine
research compound
4-(3,4-dichlorophenyl)-N-methyl-3,4-dihydro-2H-naphthalen-1-imine
MGBVAZJASCWJGJ-UHFFFAOYSA-N
CN=C1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.