2,4,6-Trifluorobenzoyl chloride is a fluorinated benzoyl chloride derivative used primarily as a pharmaceutical intermediate. Its structure features a benzene ring substituted with three fluorine atoms and a reactive acyl chloride group, making it a versatile building block in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 79538-29-7
4-(3,4-dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenone
pharmaceutical intermediate for sertraline
4-methyl-4-(methyldisulfanyl)pentanoic acid
pharmaceutical intermediate
(S)-1-N-Boc-piperazine-2-carboxylic acid methyl ester
Pharmaceutical intermediate for API synthesis
4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride
Sertraline hydrochloride related compound
2,4,6-trifluorobenzoyl chloride
SIFIJQFBERMWMU-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)C(=O)Cl)F)F
—