Tetrachlorobisphenol A is a chlorinated derivative of bisphenol A used primarily as a flame retardant monomer in the production of epoxy, polyester, and polycarbonate resins. Its structure contains four chlorine atoms and two hydroxyl groups, contributing to its flame-retardant properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 79-95-8
3,3'-Dimethylbisphenol A
Manufacture of plastics and resins
Bis(4-chlorobenzoic) anhydride
Chemical intermediate for organic synthesis
Sodium permanganate monohydrate
Oxidizing agent, chemical raw material
TRIPHENYLPHOSPHINE OXIDE
organophosphorus compound and reaction byproduct
2,6-dichloro-4-[2-(3,5-dichloro-4-hydroxyphenyl)propan-2-yl]phenol
KYPYTERUKNKOLP-UHFFFAOYSA-N
CC(C)(C1=CC(=C(C(=C1)Cl)O)Cl)C2=CC(=C(C(=C2)Cl)O)Cl